C26H44O5Si — CID 140798042
5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-propan-2-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one (PubChem CID 140798042) has the molecular formula C26H44O5Si and a molecular weight of 464.72 g/mol. Its IUPAC name is 5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-propan-2-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one.
| Compound Name | 5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-propan-2-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 140798042 |
| Molecular Formula | C26H44O5Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | 5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-propan-2-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
| SMILES | CC1=C(C(=O)C2=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C(C)C)C2(C)C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C26H44O5Si/c1-15(2)18-14-19(31-32(12,13)24(5,6)7)16(3)21(25(18,8)9)22(27)20-17(4)29-26(10,11)30-23(20)28/h15,18-19H,14H2,1-13H3/t18-,19-/m0/s1 |
| InChIKey | TWDOFCQTRQUPFA-OALUTQOASA-N |
| XLogP | 6.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|