C24H40O5Si — CID 140798047
5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-propan-2-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one (PubChem CID 140798047) has the molecular formula C24H40O5Si and a molecular weight of 436.67 g/mol. Its IUPAC name is 5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-propan-2-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one.
| Compound Name | 5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-propan-2-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 140798047 |
| Molecular Formula | C24H40O5Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-propan-2-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
| SMILES | CC1=C(C(=O)C2=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C(C)C)C2)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C24H40O5Si/c1-14(2)17-12-18(15(3)19(13-17)29-30(10,11)23(5,6)7)21(25)20-16(4)27-24(8,9)28-22(20)26/h14,17,19H,12-13H2,1-11H3/t17-,19-/m0/s1 |
| InChIKey | VQJBNSXFCHCCFO-HKUYNNGSSA-N |
| XLogP | 5.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|