C24H48O3Si2 — CID 140798052
(5S)-5-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]-2,6,6-trimethylcyclohex-2-en-1-one (PubChem CID 140798052) has the molecular formula C24H48O3Si2 and a molecular weight of 440.82 g/mol. Its IUPAC name is (5S)-5-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]-2,6,6-trimethylcyclohex-2-en-1-one.
| Compound Name | (5S)-5-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]-2,6,6-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 140798052 |
| Molecular Formula | C24H48O3Si2 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | (5S)-5-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]-2,6,6-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC[C@@H](C(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)C(C)(C)C1=O |
| InChI | InChI=1S/C24H48O3Si2/c1-18-14-15-20(24(8,9)21(18)25)19(16-26-28(10,11)22(2,3)4)17-27-29(12,13)23(5,6)7/h14,19-20H,15-17H2,1-13H3/t20-/m0/s1 |
| InChIKey | KPTVDFYETGYAQV-FQEVSTJZSA-N |
| XLogP | 7.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|