C29H40BN5O3Si — CID 140798299
tert-butyl-dimethyl-[[6-[4-(1-methylpyrazol-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-2-pyridinyl]methoxy]silane (PubChem CID 140798299) has the molecular formula C29H40BN5O3Si and a molecular weight of 545.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[6-[4-(1-methylpyrazol-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-2-pyridinyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[6-[4-(1-methylpyrazol-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-2-pyridinyl]methoxy]silane |
|---|---|
| PubChem CID | 140798299 |
| Molecular Formula | C29H40BN5O3Si |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | tert-butyl-dimethyl-[[6-[4-(1-methylpyrazol-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-2-pyridinyl]methoxy]silane |
| SMILES | Cn1ccc(-c2cc(B3OC(C)(C)C(C)(C)O3)cc3c2cnn3-c2cccc(CO[Si](C)(C)C(C)(C)C)n2)n1 |
| InChI | InChI=1S/C29H40BN5O3Si/c1-27(2,3)39(9,10)36-19-21-12-11-13-26(32-21)35-25-17-20(30-37-28(4,5)29(6,7)38-30)16-22(23(25)18-31-35)24-14-15-34(8)33-24/h11-18H,19H2,1-10H3 |
| InChIKey | RUIUBHYKKHISGG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 76.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|