C19H19BN4O2 — CID 140798356
6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]pyridine-2-carbonitrile (PubChem CID 140798356) has the molecular formula C19H19BN4O2 and a molecular weight of 346.20 g/mol. Its IUPAC name is 6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]pyridine-2-carbonitrile.
| Compound Name | 6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 140798356 |
| Molecular Formula | C19H19BN4O2 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]pyridine-2-carbonitrile |
| SMILES | CC1(C)OB(c2ccc3cnn(-c4cccc(C#N)n4)c3c2)OC1(C)C |
| InChI | InChI=1S/C19H19BN4O2/c1-18(2)19(3,4)26-20(25-18)14-9-8-13-12-22-24(16(13)10-14)17-7-5-6-15(11-21)23-17/h5-10,12H,1-4H3 |
| InChIKey | IWLGWZGSZYIQQS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|