About CID 140798455
CID 140798455 (PubChem CID 140798455) has the molecular formula C19H21BrFN3OSi
and a molecular weight of 434.39 g/mol.
Molecular Properties
| Compound Name | CID 140798455 |
| PubChem CID | 140798455 |
| Molecular Formula | C19H21BrFN3OSi |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1cccc(-n2ncc3c(F)cc(Br)cc32)n1 |
| InChI | InChI=1S/C19H21BrFN3OSi/c1-18(2,3)26-25-19(4,5)16-7-6-8-17(23-16)24-15-10-12(20)9-14(21)13(15)11-22-24/h6-11H,1-5H3 |
| InChIKey | UCWHUGYRQPHXTL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140798455 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140798455?
The IUPAC name of CID 140798455 (CID 140798455) is not available.
What is the SMILES notation for CID 140798455?
The canonical SMILES for CID 140798455 is CC(C)(C)[Si]OC(C)(C)c1cccc(-n2ncc3c(F)cc(Br)cc32)n1.
What is the InChIKey of CID 140798455?
The InChIKey is UCWHUGYRQPHXTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21BrFN3OSi/c1-18(2,3)26-25-19(4,5)16-7-6-8-17(23-16)24-15-10-12(20)9-14(21)13(15)11-22-24/h6-11H,1-5H3.
What are the key properties of CID 140798455?
CID 140798455 has a molecular weight of 434.39 g/mol, XLogP of 5.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140798455 is sourced from PubChem (CID 140798455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).