C17H20BN3O2S — CID 140798488
4-methyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-1,3-thiazole (PubChem CID 140798488) has the molecular formula C17H20BN3O2S and a molecular weight of 341.25 g/mol. Its IUPAC name is 4-methyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-1,3-thiazole.
| Compound Name | 4-methyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 140798488 |
| Molecular Formula | C17H20BN3O2S |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-methyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-1,3-thiazole |
| SMILES | Cc1csc(-n2ncc3ccc(B4OC(C)(C)C(C)(C)O4)cc32)n1 |
| InChI | InChI=1S/C17H20BN3O2S/c1-11-10-24-15(20-11)21-14-8-13(7-6-12(14)9-19-21)18-22-16(2,3)17(4,5)23-18/h6-10H,1-5H3 |
| InChIKey | KXODCMJPQUSNGK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|