About [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane
[diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane (PubChem CID 140798719) has the molecular formula C19H38O4Si2
and a molecular weight of 386.68 g/mol. Its IUPAC name is [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane.
Molecular Properties
| Compound Name | [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane |
| PubChem CID | 140798719 |
| Molecular Formula | C19H38O4Si2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane |
| SMILES | CCO[Si](C)(C[Si](OCC)(OCC)C1=CC=C(C(C)C)CC1)OCC |
| InChI | InChI=1S/C19H38O4Si2/c1-8-20-24(7,21-9-2)16-25(22-10-3,23-11-4)19-14-12-18(13-15-19)17(5)6/h12,14,17H,8-11,13,15-16H2,1-7H3 |
| InChIKey | FQNWMMOTBFJPLN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane?
The IUPAC name of [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane (CID 140798719) is [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane.
What is the SMILES notation for [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane?
The canonical SMILES for [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane is CCO[Si](C)(C[Si](OCC)(OCC)C1=CC=C(C(C)C)CC1)OCC.
What is the InChIKey of [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane?
The InChIKey is FQNWMMOTBFJPLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O4Si2/c1-8-20-24(7,21-9-2)16-25(22-10-3,23-11-4)19-14-12-18(13-15-19)17(5)6/h12,14,17H,8-11,13,15-16H2,1-7H3.
What are the key properties of [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane?
[diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane has a molecular weight of 386.68 g/mol, XLogP of 5.03, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [diethoxy(methyl)silyl]methyl-diethoxy-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)silane is sourced from PubChem (CID 140798719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).