About [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol
[2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol (PubChem CID 140798724) has the molecular formula C10H11Cl2FO2
and a molecular weight of 253.10 g/mol. Its IUPAC name is [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol.
Molecular Properties
| Compound Name | [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol |
| PubChem CID | 140798724 |
| Molecular Formula | C10H11Cl2FO2 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol |
| SMILES | OCc1ccc(OCCCF)c(Cl)c1Cl |
| InChI | InChI=1S/C10H11Cl2FO2/c11-9-7(6-14)2-3-8(10(9)12)15-5-1-4-13/h2-3,14H,1,4-6H2 |
| InChIKey | LPEGOAPUPRRFKB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol?
The IUPAC name of [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol (CID 140798724) is [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol.
What is the SMILES notation for [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol?
The canonical SMILES for [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol is OCc1ccc(OCCCF)c(Cl)c1Cl.
What is the InChIKey of [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol?
The InChIKey is LPEGOAPUPRRFKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2FO2/c11-9-7(6-14)2-3-8(10(9)12)15-5-1-4-13/h2-3,14H,1,4-6H2.
What are the key properties of [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol?
[2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol has a molecular weight of 253.10 g/mol, XLogP of 3.22, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-dichloro-4-(3-fluoropropoxy)phenyl]methanol is sourced from PubChem (CID 140798724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).