C39H21N5 — CID 140799305
17-[4-(4-isocyanophenyl)quinazolin-2-yl]-8,17-diazaheptacyclo[13.10.1.02,7.08,26.09,14.016,24.018,23]hexacosa-1(25),2,4,6,9,11,13,15(26),16(24),18,20,22-dodecaene (PubChem CID 140799305) has the molecular formula C39H21N5 and a molecular weight of 559.63 g/mol. Its IUPAC name is 17-[4-(4-isocyanophenyl)quinazolin-2-yl]-8,17-diazaheptacyclo[13.10.1.02,7.08,26.09,14.016,24.018,23]hexacosa-1(25),2,4,6,9,11,13,15(26),16(24),18,20,22-dodecaene.
| Compound Name | 17-[4-(4-isocyanophenyl)quinazolin-2-yl]-8,17-diazaheptacyclo[13.10.1.02,7.08,26.09,14.016,24.018,23]hexacosa-1(25),2,4,6,9,11,13,15(26),16(24),18,20,22-dodecaene |
|---|---|
| PubChem CID | 140799305 |
| Molecular Formula | C39H21N5 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 17-[4-(4-isocyanophenyl)quinazolin-2-yl]-8,17-diazaheptacyclo[13.10.1.02,7.08,26.09,14.016,24.018,23]hexacosa-1(25),2,4,6,9,11,13,15(26),16(24),18,20,22-dodecaene |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-n3c4ccccc4c4cc5c6ccccc6n6c7ccccc7c(c43)c56)nc3ccccc23)cc1 |
| InChI | InChI=1S/C39H21N5/c1-40-24-20-18-23(19-21-24)36-27-12-2-6-14-31(27)41-39(42-36)44-33-16-8-4-11-26(33)30-22-29-25-10-3-7-15-32(25)43-34-17-9-5-13-28(34)35(37(29)43)38(30)44/h2-22H |
| InChIKey | ARWBYEBUANTODQ-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 39.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|