About (2R)-1,1-diethoxy-3-methoxypropan-2-ol
(2R)-1,1-diethoxy-3-methoxypropan-2-ol (PubChem CID 14079965) has the molecular formula C8H18O4
and a molecular weight of 178.23 g/mol. Its IUPAC name is (2R)-1,1-diethoxy-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | (2R)-1,1-diethoxy-3-methoxypropan-2-ol |
| PubChem CID | 14079965 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (2R)-1,1-diethoxy-3-methoxypropan-2-ol |
| SMILES | CCOC(OCC)[C@H](O)COC |
| InChI | InChI=1S/C8H18O4/c1-4-11-8(12-5-2)7(9)6-10-3/h7-9H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | NBNZLCUVFGPBOC-SSDOTTSWSA-N |
| XLogP | 0.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,1-diethoxy-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1-diethoxy-3-methoxypropan-2-ol?
The IUPAC name of (2R)-1,1-diethoxy-3-methoxypropan-2-ol (CID 14079965) is (2R)-1,1-diethoxy-3-methoxypropan-2-ol.
What is the SMILES notation for (2R)-1,1-diethoxy-3-methoxypropan-2-ol?
The canonical SMILES for (2R)-1,1-diethoxy-3-methoxypropan-2-ol is CCOC(OCC)[C@H](O)COC.
What is the InChIKey of (2R)-1,1-diethoxy-3-methoxypropan-2-ol?
The InChIKey is NBNZLCUVFGPBOC-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H18O4/c1-4-11-8(12-5-2)7(9)6-10-3/h7-9H,4-6H2,1-3H3/t7-/m1/s1.
What are the key properties of (2R)-1,1-diethoxy-3-methoxypropan-2-ol?
(2R)-1,1-diethoxy-3-methoxypropan-2-ol has a molecular weight of 178.23 g/mol, XLogP of 0.39, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1-diethoxy-3-methoxypropan-2-ol is sourced from PubChem (CID 14079965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).