C6H7F5NO4S- — CID 140799778
2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]ethanesulfonate (PubChem CID 140799778) has the molecular formula C6H7F5NO4S- and a molecular weight of 284.18 g/mol. Its IUPAC name is 2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]ethanesulfonate.
| Compound Name | 2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]ethanesulfonate |
|---|---|
| PubChem CID | 140799778 |
| Molecular Formula | C6H7F5NO4S- |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]ethanesulfonate |
| SMILES | CN(CCS(=O)(=O)[O-])C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5NO4S/c1-12(2-3-17(14,15)16)4(13)5(7,8)6(9,10)11/h2-3H2,1H3,(H,14,15,16)/p-1 |
| InChIKey | FDKFHVJCNMXVEK-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|