C8H15F3N2O4S — CID 140799779
[dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azaniumyl]methanesulfonate (PubChem CID 140799779) has the molecular formula C8H15F3N2O4S and a molecular weight of 292.28 g/mol. Its IUPAC name is [dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azaniumyl]methanesulfonate.
| Compound Name | [dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azaniumyl]methanesulfonate |
|---|---|
| PubChem CID | 140799779 |
| Molecular Formula | C8H15F3N2O4S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | [dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azaniumyl]methanesulfonate |
| SMILES | C[N+](C)(CCCNC(=O)C(F)(F)F)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H15F3N2O4S/c1-13(2,6-18(15,16)17)5-3-4-12-7(14)8(9,10)11/h3-6H2,1-2H3,(H-,12,14,15,16,17) |
| InChIKey | LPFVFZNLLAGBJR-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|