C27H19Cl3F7NO2 — CID 140800251
3-[(1R)-1-(3-methoxyphenyl)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 140800251) has the molecular formula C27H19Cl3F7NO2 and a molecular weight of 628.80 g/mol. Its IUPAC name is 3-[(1R)-1-(3-methoxyphenyl)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 3-[(1R)-1-(3-methoxyphenyl)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140800251 |
| Molecular Formula | C27H19Cl3F7NO2 |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 627.04 |
| IUPAC Name | 3-[(1R)-1-(3-methoxyphenyl)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | COc1cccc([C@@H](C)c2c(/C(F)=C/C(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)ccc(C(N)=O)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C27H19Cl3F7NO2/c1-12(13-4-3-5-15(8-13)40-2)22-16(6-7-17(25(38)39)23(22)27(35,36)37)21(31)11-18(26(32,33)34)14-9-19(28)24(30)20(29)10-14/h3-12,18H,1-2H3,(H2,38,39)/b21-11-/t12-,18?/m1/s1 |
| InChIKey | JWJZBGXNWZDOJP-LYSGVXOBSA-N |
| XLogP | 9.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|