C23H17Cl3F9NO3S — CID 140800290
3-[(2R)-1-(2,2-difluoroethylsulfonyl)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 140800290) has the molecular formula C23H17Cl3F9NO3S and a molecular weight of 664.80 g/mol. Its IUPAC name is 3-[(2R)-1-(2,2-difluoroethylsulfonyl)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 3-[(2R)-1-(2,2-difluoroethylsulfonyl)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140800290 |
| Molecular Formula | C23H17Cl3F9NO3S |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 662.99 |
| IUPAC Name | 3-[(2R)-1-(2,2-difluoroethylsulfonyl)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](CS(=O)(=O)CC(F)F)c1c(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc(C(N)=O)c1C(F)(F)F |
| InChI | InChI=1S/C23H17Cl3F9NO3S/c1-9(7-40(38,39)8-17(28)29)18-11(2-3-12(21(36)37)19(18)23(33,34)35)16(27)6-13(22(30,31)32)10-4-14(24)20(26)15(25)5-10/h2-6,9,13,17H,7-8H2,1H3,(H2,36,37)/b16-6-/t9-,13?/m0/s1 |
| InChIKey | KEYXVCTWEFAJOW-ZUJCBNHXSA-N |
| XLogP | 8.20 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|