About (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine
(2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine (PubChem CID 140800499) has the molecular formula C36H47NO2Si2
and a molecular weight of 581.95 g/mol. Its IUPAC name is (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine.
Molecular Properties
| Compound Name | (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine |
| PubChem CID | 140800499 |
| Molecular Formula | C36H47NO2Si2 |
| Molecular Weight | 581.95 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine |
| SMILES | CC(C)(C)[Si](OCC[C@H](N)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H47NO2Si2/c1-35(2,3)40(31-19-11-7-12-20-31,32-21-13-8-14-22-32)38-28-27-30(37)29-39-41(36(4,5)6,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h7-26,30H,27-29,37H2,1-6H3/t30-/m0/s1 |
| InChIKey | IGQOGXDMOAYQHF-PMERELPUSA-N |
| XLogP | 5.86 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 581.95 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine?
The IUPAC name of (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine (CID 140800499) is (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine.
What is the SMILES notation for (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine?
The canonical SMILES for (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine is CC(C)(C)[Si](OCC[C@H](N)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine?
The InChIKey is IGQOGXDMOAYQHF-PMERELPUSA-N. The full InChI is InChI=1S/C36H47NO2Si2/c1-35(2,3)40(31-19-11-7-12-20-31,32-21-13-8-14-22-32)38-28-27-30(37)29-39-41(36(4,5)6,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h7-26,30H,27-29,37H2,1-6H3/t30-/m0/s1.
What are the key properties of (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine?
(2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine has a molecular weight of 581.95 g/mol, XLogP of 5.86, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]butan-2-amine is sourced from PubChem (CID 140800499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).