C17H20ClFN4OSi — CID 140800631
2-[[5-chloro-3-(2-fluoro-4-pyridinyl)pyrazolo[3,4-c]pyridin-2-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140800631) has the molecular formula C17H20ClFN4OSi and a molecular weight of 378.91 g/mol. Its IUPAC name is 2-[[5-chloro-3-(2-fluoro-4-pyridinyl)pyrazolo[3,4-c]pyridin-2-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-chloro-3-(2-fluoro-4-pyridinyl)pyrazolo[3,4-c]pyridin-2-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140800631 |
| Molecular Formula | C17H20ClFN4OSi |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 2-[[5-chloro-3-(2-fluoro-4-pyridinyl)pyrazolo[3,4-c]pyridin-2-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc2cnc(Cl)cc2c1-c1ccnc(F)c1 |
| InChI | InChI=1S/C17H20ClFN4OSi/c1-25(2,3)7-6-24-11-23-17(12-4-5-20-16(19)8-12)13-9-15(18)21-10-14(13)22-23/h4-5,8-10H,6-7,11H2,1-3H3 |
| InChIKey | JFXWYCVJIYDTII-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|