About 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate
6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate (PubChem CID 140800648) has the molecular formula C19H23N7O2
and a molecular weight of 381.44 g/mol. Its IUPAC name is 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate.
Molecular Properties
| Compound Name | 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate |
| PubChem CID | 140800648 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate |
| SMILES | CCc1ccnc2ccc(Nc3nc(NC4CC4)c4[nH]cnc4n3)cc12.O.O |
| InChI | InChI=1S/C19H19N7.2H2O/c1-2-11-7-8-20-15-6-5-13(9-14(11)15)24-19-25-17-16(21-10-22-17)18(26-19)23-12-3-4-12;;/h5-10,12H,2-4H2,1H3,(H3,21,22,23,24,25,26);2*1H2 |
| InChIKey | HOFHQJDPANHKHI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 154.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate?
The IUPAC name of 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate (CID 140800648) is 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate.
What is the SMILES notation for 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate?
The canonical SMILES for 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate is CCc1ccnc2ccc(Nc3nc(NC4CC4)c4[nH]cnc4n3)cc12.O.O.
What is the InChIKey of 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate?
The InChIKey is HOFHQJDPANHKHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N7.2H2O/c1-2-11-7-8-20-15-6-5-13(9-14(11)15)24-19-25-17-16(21-10-22-17)18(26-19)23-12-3-4-12;;/h5-10,12H,2-4H2,1H3,(H3,21,22,23,24,25,26);2*1H2.
What are the key properties of 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate?
6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate has a molecular weight of 381.44 g/mol, XLogP of 2.13, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-cyclopropyl-2-N-(4-ethylquinolin-6-yl)-7H-purine-2,6-diamine;dihydrate is sourced from PubChem (CID 140800648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).