C59H72N3O2+ — CID 140800734
[2-[[4-[bis[4-(2,4,6-trimethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 140800734) has the molecular formula C59H72N3O2+ and a molecular weight of 855.24 g/mol. Its IUPAC name is [2-[[4-[bis[4-(2,4,6-trimethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [2-[[4-[bis[4-(2,4,6-trimethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 140800734 |
| Molecular Formula | C59H72N3O2+ |
| Molecular Weight | 855.24 g/mol |
| Exact Mass | 854.56 |
| IUPAC Name | [2-[[4-[bis[4-(2,4,6-trimethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | Cc1cc(C)c(Nc2ccc([C+](c3ccc(Nc4c(C)cc(C)cc4C)cc3)c3ccc(NC4CCCCC4OC(=O)C(C)(CC(C)(C)C)C(C)(C)C)c4ccccc34)cc2)c(C)c1 |
| InChI | InChI=1S/C59H72N3O2/c1-37-32-39(3)54(40(4)33-37)60-45-26-22-43(23-27-45)53(44-24-28-46(29-25-44)61-55-41(5)34-38(2)35-42(55)6)49-30-31-50(48-19-15-14-18-47(48)49)62-51-20-16-17-21-52(51)64-56(63)59(13,58(10,11)12)36-57(7,8)9/h14-15,18-19,22-35,51-52,60-62H,16-17,20-21,36H2,1-13H3/q+1 |
| InChIKey | MOUSYSFTFLZHOO-UHFFFAOYSA-N |
| XLogP | 15.95 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.24 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|