C36H43N2O4- — CID 140801093
(2S,3R)-3-cyclopropyl-3-[2-[3-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]-4-(2-methoxy-4-pyridinyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoate (PubChem CID 140801093) has the molecular formula C36H43N2O4- and a molecular weight of 567.75 g/mol. Its IUPAC name is (2S,3R)-3-cyclopropyl-3-[2-[3-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]-4-(2-methoxy-4-pyridinyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoate.
| Compound Name | (2S,3R)-3-cyclopropyl-3-[2-[3-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]-4-(2-methoxy-4-pyridinyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 140801093 |
| Molecular Formula | C36H43N2O4- |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | (2S,3R)-3-cyclopropyl-3-[2-[3-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]-4-(2-methoxy-4-pyridinyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoate |
| SMILES | COc1cc(-c2ccc(C3CCc4ccc([C@H](C5CC5)[C@H](C)C(=O)[O-])cc4O3)cc2CN2[C@H](C)CCC[C@@H]2C)ccn1 |
| InChI | InChI=1S/C36H44N2O4/c1-22-6-5-7-23(2)38(22)21-30-18-28(12-14-31(30)27-16-17-37-34(20-27)41-4)32-15-13-25-8-11-29(19-33(25)42-32)35(26-9-10-26)24(3)36(39)40/h8,11-12,14,16-20,22-24,26,32,35H,5-7,9-10,13,15,21H2,1-4H3,(H,39,40)/p-1/t22-,23+,24-,32?,35-/m0/s1 |
| InChIKey | HEMHNYUOUBQDDR-SNXDYWKISA-M |
| XLogP | 6.47 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |