About 2-methylidenepropane-1,3-diol;bis(rutherfordium)
2-methylidenepropane-1,3-diol;bis(rutherfordium) (PubChem CID 140801479) has the molecular formula C4H8O2Rf2
and a molecular weight of 622.11 g/mol. Its IUPAC name is 2-methylidenepropane-1,3-diol;bis(rutherfordium).
Molecular Properties
| Compound Name | 2-methylidenepropane-1,3-diol;bis(rutherfordium) |
| PubChem CID | 140801479 |
| Molecular Formula | C4H8O2Rf2 |
| Molecular Weight | 622.11 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | 2-methylidenepropane-1,3-diol;bis(rutherfordium) |
| SMILES | C=C(CO)CO.[Rf].[Rf] |
| InChI | InChI=1S/C4H8O2.2Rf/c1-4(2-5)3-6;;/h5-6H,1-3H2;; |
| InChIKey | IEGYLIGMMXUXEY-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 622.11 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenepropane-1,3-diol;bis(rutherfordium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenepropane-1,3-diol;bis(rutherfordium)?
The IUPAC name of 2-methylidenepropane-1,3-diol;bis(rutherfordium) (CID 140801479) is 2-methylidenepropane-1,3-diol;bis(rutherfordium).
What is the SMILES notation for 2-methylidenepropane-1,3-diol;bis(rutherfordium)?
The canonical SMILES for 2-methylidenepropane-1,3-diol;bis(rutherfordium) is C=C(CO)CO.[Rf].[Rf].
What is the InChIKey of 2-methylidenepropane-1,3-diol;bis(rutherfordium)?
The InChIKey is IEGYLIGMMXUXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.2Rf/c1-4(2-5)3-6;;/h5-6H,1-3H2;;.
What are the key properties of 2-methylidenepropane-1,3-diol;bis(rutherfordium)?
2-methylidenepropane-1,3-diol;bis(rutherfordium) has a molecular weight of 622.11 g/mol, XLogP of -0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenepropane-1,3-diol;bis(rutherfordium) is sourced from PubChem (CID 140801479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).