C18H10Cl3N3OS — CID 140801895
N-[(S)-(5-chloro-2-pyridinyl)-(3,4-dichlorophenyl)methyl]-4-isocyanothiophene-2-carboxamide (PubChem CID 140801895) has the molecular formula C18H10Cl3N3OS and a molecular weight of 422.72 g/mol. Its IUPAC name is N-[(S)-(5-chloro-2-pyridinyl)-(3,4-dichlorophenyl)methyl]-4-isocyanothiophene-2-carboxamide.
| Compound Name | N-[(S)-(5-chloro-2-pyridinyl)-(3,4-dichlorophenyl)methyl]-4-isocyanothiophene-2-carboxamide |
|---|---|
| PubChem CID | 140801895 |
| Molecular Formula | C18H10Cl3N3OS |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 420.96 |
| IUPAC Name | N-[(S)-(5-chloro-2-pyridinyl)-(3,4-dichlorophenyl)methyl]-4-isocyanothiophene-2-carboxamide |
| SMILES | [C-]#[N+]c1csc(C(=O)N[C@@H](c2ccc(Cl)c(Cl)c2)c2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C18H10Cl3N3OS/c1-22-12-7-16(26-9-12)18(25)24-17(15-5-3-11(19)8-23-15)10-2-4-13(20)14(21)6-10/h2-9,17H,(H,24,25)/t17-/m0/s1 |
| InChIKey | VDAQIBGESFRAFT-KRWDZBQOSA-N |
| XLogP | 6.17 |
| TPSA | 46.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|