C12H16Cl2F3NOSi — CID 140801933
2,6-dichloro-4-[(2R)-1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl]aniline (PubChem CID 140801933) has the molecular formula C12H16Cl2F3NOSi and a molecular weight of 346.25 g/mol. Its IUPAC name is 2,6-dichloro-4-[(2R)-1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl]aniline.
| Compound Name | 2,6-dichloro-4-[(2R)-1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl]aniline |
|---|---|
| PubChem CID | 140801933 |
| Molecular Formula | C12H16Cl2F3NOSi |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2,6-dichloro-4-[(2R)-1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl]aniline |
| SMILES | C[C@@](O[Si](C)(C)C)(c1cc(Cl)c(N)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C12H16Cl2F3NOSi/c1-11(12(15,16)17,19-20(2,3)4)7-5-8(13)10(18)9(14)6-7/h5-6H,18H2,1-4H3/t11-/m1/s1 |
| InChIKey | KGGZMDIGCJIXTJ-LLVKDONJSA-N |
| XLogP | 5.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|