About 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline
2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline (PubChem CID 140801935) has the molecular formula C12H17Cl2F2NOSi
and a molecular weight of 328.26 g/mol. Its IUPAC name is 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline.
Molecular Properties
| Compound Name | 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline |
| PubChem CID | 140801935 |
| Molecular Formula | C12H17Cl2F2NOSi |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline |
| SMILES | CC(O[Si](C)(C)C)(c1cc(Cl)c(N)c(Cl)c1)C(F)F |
| InChI | InChI=1S/C12H17Cl2F2NOSi/c1-12(11(15)16,18-19(2,3)4)7-5-8(13)10(17)9(14)6-7/h5-6,11H,17H2,1-4H3 |
| InChIKey | QLUNPULGBFDVIS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline?
The IUPAC name of 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline (CID 140801935) is 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline.
What is the SMILES notation for 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline?
The canonical SMILES for 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline is CC(O[Si](C)(C)C)(c1cc(Cl)c(N)c(Cl)c1)C(F)F.
What is the InChIKey of 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline?
The InChIKey is QLUNPULGBFDVIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl2F2NOSi/c1-12(11(15)16,18-19(2,3)4)7-5-8(13)10(17)9(14)6-7/h5-6,11H,17H2,1-4H3.
What are the key properties of 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline?
2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline has a molecular weight of 328.26 g/mol, XLogP of 4.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-(1,1-difluoro-2-trimethylsilyloxypropan-2-yl)aniline is sourced from PubChem (CID 140801935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).