C12H15Cl2F4NOSi — CID 140801937
2,6-dichloro-3-fluoro-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline (PubChem CID 140801937) has the molecular formula C12H15Cl2F4NOSi and a molecular weight of 364.24 g/mol. Its IUPAC name is 2,6-dichloro-3-fluoro-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline.
| Compound Name | 2,6-dichloro-3-fluoro-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline |
|---|---|
| PubChem CID | 140801937 |
| Molecular Formula | C12H15Cl2F4NOSi |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 2,6-dichloro-3-fluoro-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline |
| SMILES | CC(O[Si](C)(C)C)(c1cc(Cl)c(N)c(Cl)c1F)C(F)(F)F |
| InChI | InChI=1S/C12H15Cl2F4NOSi/c1-11(12(16,17)18,20-21(2,3)4)6-5-7(13)10(19)8(14)9(6)15/h5H,19H2,1-4H3 |
| InChIKey | UOCCIUVAVAWYGG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|