About 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline
2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline (PubChem CID 140801942) has the molecular formula C13H19ClF3NOSi
and a molecular weight of 325.83 g/mol. Its IUPAC name is 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline.
Molecular Properties
| Compound Name | 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline |
| PubChem CID | 140801942 |
| Molecular Formula | C13H19ClF3NOSi |
| Molecular Weight | 325.83 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline |
| SMILES | Cc1cc(C(C)(O[Si](C)(C)C)C(F)(F)F)cc(Cl)c1N |
| InChI | InChI=1S/C13H19ClF3NOSi/c1-8-6-9(7-10(14)11(8)18)12(2,13(15,16)17)19-20(3,4)5/h6-7H,18H2,1-5H3 |
| InChIKey | IFQLWJXRCRSTAG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.83 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline?
The IUPAC name of 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline (CID 140801942) is 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline.
What is the SMILES notation for 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline?
The canonical SMILES for 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline is Cc1cc(C(C)(O[Si](C)(C)C)C(F)(F)F)cc(Cl)c1N.
What is the InChIKey of 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline?
The InChIKey is IFQLWJXRCRSTAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClF3NOSi/c1-8-6-9(7-10(14)11(8)18)12(2,13(15,16)17)19-20(3,4)5/h6-7H,18H2,1-5H3.
What are the key properties of 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline?
2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline has a molecular weight of 325.83 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-methyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline is sourced from PubChem (CID 140801942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).