C13H18Cl2F3NOSi — CID 140801951
2,6-dichloro-4-(4,4,4-trifluoro-2-trimethylsilyloxybutan-2-yl)aniline (PubChem CID 140801951) has the molecular formula C13H18Cl2F3NOSi and a molecular weight of 360.28 g/mol. Its IUPAC name is 2,6-dichloro-4-(4,4,4-trifluoro-2-trimethylsilyloxybutan-2-yl)aniline.
| Compound Name | 2,6-dichloro-4-(4,4,4-trifluoro-2-trimethylsilyloxybutan-2-yl)aniline |
|---|---|
| PubChem CID | 140801951 |
| Molecular Formula | C13H18Cl2F3NOSi |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2,6-dichloro-4-(4,4,4-trifluoro-2-trimethylsilyloxybutan-2-yl)aniline |
| SMILES | CC(CC(F)(F)F)(O[Si](C)(C)C)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2F3NOSi/c1-12(7-13(16,17)18,20-21(2,3)4)8-5-9(14)11(19)10(15)6-8/h5-6H,7,19H2,1-4H3 |
| InChIKey | IFWKYVKJCJFLQA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|