C41H55NOSi — CID 140802088
4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-(2,5-dimethyl-6,6a,10a,10b-tetrahydro-5aH-indeno[2,1-b]indol-6-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 140802088) has the molecular formula C41H55NOSi and a molecular weight of 605.98 g/mol. Its IUPAC name is 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-(2,5-dimethyl-6,6a,10a,10b-tetrahydro-5aH-indeno[2,1-b]indol-6-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-(2,5-dimethyl-6,6a,10a,10b-tetrahydro-5aH-indeno[2,1-b]indol-6-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 140802088 |
| Molecular Formula | C41H55NOSi |
| Molecular Weight | 605.98 g/mol |
| Exact Mass | 605.41 |
| IUPAC Name | 4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl-(2,5-dimethyl-6,6a,10a,10b-tetrahydro-5aH-indeno[2,1-b]indol-6-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | Cc1ccc2c(c1)C1C3C=CC=CC3C([Si](C)(CCCCCCOC(C)(C)C)C3C4C=CC=CC4C4C=CC=CC43)C1N2C |
| InChI | InChI=1S/C41H55NOSi/c1-28-23-24-36-35(27-28)37-31-19-11-14-22-34(31)40(38(37)42(36)5)44(6,26-16-8-7-15-25-43-41(2,3)4)39-32-20-12-9-17-29(32)30-18-10-13-21-33(30)39/h9-14,17-24,27,29-34,37-40H,7-8,15-16,25-26H2,1-6H3 |
| InChIKey | IIJZYBNECHNWKO-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.98 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|