About CID 140802258
CID 140802258 (PubChem CID 140802258) has the molecular formula C24H28AlN2O2
and a molecular weight of 403.48 g/mol.
Molecular Properties
| Compound Name | CID 140802258 |
| PubChem CID | 140802258 |
| Molecular Formula | C24H28AlN2O2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c2c(c1)/C=N/C1CCCCC1/N=C/c1cc(C)cc(C)c1O[Al]O2 |
| InChI | InChI=1S/C24H30N2O2.Al/c1-15-9-17(3)23(27)19(11-15)13-25-21-7-5-6-8-22(21)26-14-20-12-16(2)10-18(4)24(20)28;/h9-14,21-22,27-28H,5-8H2,1-4H3;/q;+2/p-2/b25-13+,26-14+; |
| InChIKey | CPXIUSSQFHRMIV-RXQQCVBLSA-L |
| XLogP | 5.07 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 140802258 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140802258?
The IUPAC name of CID 140802258 (CID 140802258) is not available.
What is the SMILES notation for CID 140802258?
The canonical SMILES for CID 140802258 is Cc1cc(C)c2c(c1)/C=N/C1CCCCC1/N=C/c1cc(C)cc(C)c1O[Al]O2.
What is the InChIKey of CID 140802258?
The InChIKey is CPXIUSSQFHRMIV-RXQQCVBLSA-L. The full InChI is InChI=1S/C24H30N2O2.Al/c1-15-9-17(3)23(27)19(11-15)13-25-21-7-5-6-8-22(21)26-14-20-12-16(2)10-18(4)24(20)28;/h9-14,21-22,27-28H,5-8H2,1-4H3;/q;+2/p-2/b25-13+,26-14+;.
What are the key properties of CID 140802258?
CID 140802258 has a molecular weight of 403.48 g/mol, XLogP of 5.07, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140802258 is sourced from PubChem (CID 140802258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).