C29H25F6N2O+ — CID 140802300
2,6,7-trimethyl-8-[1-methyl-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]quinolin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 140802300) has the molecular formula C29H25F6N2O+ and a molecular weight of 531.52 g/mol. Its IUPAC name is 2,6,7-trimethyl-8-[1-methyl-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]quinolin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,6,7-trimethyl-8-[1-methyl-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]quinolin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 140802300 |
| Molecular Formula | C29H25F6N2O+ |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 2,6,7-trimethyl-8-[1-methyl-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]quinolin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3ccc4c(CC(C)(C(F)(F)F)C(F)(F)F)cccc4[n+]3C)c(C)c(C)cc12 |
| InChI | InChI=1S/C29H25F6N2O/c1-15-13-21-20-10-9-16(2)36-26(20)38-25(21)24(17(15)3)23-12-11-19-18(7-6-8-22(19)37(23)5)14-27(4,28(30,31)32)29(33,34)35/h6-13H,14H2,1-5H3/q+1 |
| InChIKey | DHFWVAMBGQZOIR-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|