About CID 140802541
CID 140802541 (PubChem CID 140802541) has the molecular formula C18H13BNO
and a molecular weight of 270.12 g/mol.
Molecular Properties
| Compound Name | CID 140802541 |
| PubChem CID | 140802541 |
| Molecular Formula | C18H13BNO |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | — |
| SMILES | O[B]c1cccc(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C18H13BNO/c21-19-13-6-5-7-14(12-13)20-17-10-3-1-8-15(17)16-9-2-4-11-18(16)20/h1-12,21H |
| InChIKey | ZRITYFVOVIXXPO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140802541 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140802541?
The IUPAC name of CID 140802541 (CID 140802541) is not available.
What is the SMILES notation for CID 140802541?
The canonical SMILES for CID 140802541 is O[B]c1cccc(-n2c3ccccc3c3ccccc32)c1.
What is the InChIKey of CID 140802541?
The InChIKey is ZRITYFVOVIXXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BNO/c21-19-13-6-5-7-14(12-13)20-17-10-3-1-8-15(17)16-9-2-4-11-18(16)20/h1-12,21H.
What are the key properties of CID 140802541?
CID 140802541 has a molecular weight of 270.12 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140802541 is sourced from PubChem (CID 140802541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).