C25H23N7 — CID 140802619
1-(2H-indazol-3-yl)-N-(2H-indazol-3-ylmethyl)-N-[(1-methylindazol-3-yl)methyl]methanamine (PubChem CID 140802619) has the molecular formula C25H23N7 and a molecular weight of 421.51 g/mol. Its IUPAC name is 1-(2H-indazol-3-yl)-N-(2H-indazol-3-ylmethyl)-N-[(1-methylindazol-3-yl)methyl]methanamine.
| Compound Name | 1-(2H-indazol-3-yl)-N-(2H-indazol-3-ylmethyl)-N-[(1-methylindazol-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 140802619 |
| Molecular Formula | C25H23N7 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-(2H-indazol-3-yl)-N-(2H-indazol-3-ylmethyl)-N-[(1-methylindazol-3-yl)methyl]methanamine |
| SMILES | Cn1nc(CN(Cc2[nH]nc3ccccc23)Cc2[nH]nc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C25H23N7/c1-31-25-13-7-4-10-19(25)24(30-31)16-32(14-22-17-8-2-5-11-20(17)26-28-22)15-23-18-9-3-6-12-21(18)27-29-23/h2-13H,14-16H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | HTGMCEOFKOREAQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |