C15H20N2O — CID 140802897
6-phenoxy-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine (PubChem CID 140802897) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 6-phenoxy-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine.
| Compound Name | 6-phenoxy-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 140802897 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 6-phenoxy-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
| SMILES | c1ccc(OC2CCCCC3=NCCCN32)cc1 |
| InChI | InChI=1S/C15H20N2O/c1-2-7-13(8-3-1)18-15-10-5-4-9-14-16-11-6-12-17(14)15/h1-3,7-8,15H,4-6,9-12H2 |
| InChIKey | XIVJZJLTHIDWNQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |