C18H19ClN4O2S — CID 140803681
1-[2-[(5-chloro-2-methylphenoxy)methyl]-3-ethylsulfanylphenyl]-4-methyltetrazol-5-one (PubChem CID 140803681) has the molecular formula C18H19ClN4O2S and a molecular weight of 390.90 g/mol. Its IUPAC name is 1-[2-[(5-chloro-2-methylphenoxy)methyl]-3-ethylsulfanylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(5-chloro-2-methylphenoxy)methyl]-3-ethylsulfanylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140803681 |
| Molecular Formula | C18H19ClN4O2S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-[2-[(5-chloro-2-methylphenoxy)methyl]-3-ethylsulfanylphenyl]-4-methyltetrazol-5-one |
| SMILES | CCSc1cccc(-n2nnn(C)c2=O)c1COc1cc(Cl)ccc1C |
| InChI | InChI=1S/C18H19ClN4O2S/c1-4-26-17-7-5-6-15(23-18(24)22(3)20-21-23)14(17)11-25-16-10-13(19)9-8-12(16)2/h5-10H,4,11H2,1-3H3 |
| InChIKey | UWLJXPLFDRLOGV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |