About chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine
chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine (PubChem CID 140804372) has the molecular formula C18H18ClN3Pt
and a molecular weight of 506.89 g/mol. Its IUPAC name is chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine.
Molecular Properties
| Compound Name | chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine |
| PubChem CID | 140804372 |
| Molecular Formula | C18H18ClN3Pt |
| Molecular Weight | 506.89 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine |
| SMILES | Cl[Pt+].Cn1ccnc1-c1cccc(C(C)(C)c2[c-]cccc2)n1 |
| InChI | InChI=1S/C18H18N3.ClH.Pt/c1-18(2,14-8-5-4-6-9-14)16-11-7-10-15(20-16)17-19-12-13-21(17)3;;/h4-8,10-13H,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | TWDLJYBIQBZTOB-UHFFFAOYSA-M |
| XLogP | 4.30 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.89 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine?
The IUPAC name of chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine (CID 140804372) is chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine.
What is the SMILES notation for chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine?
The canonical SMILES for chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine is Cl[Pt+].Cn1ccnc1-c1cccc(C(C)(C)c2[c-]cccc2)n1.
What is the InChIKey of chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine?
The InChIKey is TWDLJYBIQBZTOB-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H18N3.ClH.Pt/c1-18(2,14-8-5-4-6-9-14)16-11-7-10-15(20-16)17-19-12-13-21(17)3;;/h4-8,10-13H,1-3H3;1H;/q-1;;+2/p-1.
What are the key properties of chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine?
chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine has a molecular weight of 506.89 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloroplatinum(1+);2-(1-methylimidazol-2-yl)-6-(2-phenylpropan-2-yl)pyridine is sourced from PubChem (CID 140804372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).