C21H22FN4O2S+ — CID 140806562
N-[(4aR,7aR)-1-(5-acetamido-2-fluorophenyl)-4,4a,5,6,7,7a-hexahydropyrrolo[3,4-d][1,3]thiazin-1-ium-2-yl]benzamide (PubChem CID 140806562) has the molecular formula C21H22FN4O2S+ and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[(4aR,7aR)-1-(5-acetamido-2-fluorophenyl)-4,4a,5,6,7,7a-hexahydropyrrolo[3,4-d][1,3]thiazin-1-ium-2-yl]benzamide.
| Compound Name | N-[(4aR,7aR)-1-(5-acetamido-2-fluorophenyl)-4,4a,5,6,7,7a-hexahydropyrrolo[3,4-d][1,3]thiazin-1-ium-2-yl]benzamide |
|---|---|
| PubChem CID | 140806562 |
| Molecular Formula | C21H22FN4O2S+ |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[(4aR,7aR)-1-(5-acetamido-2-fluorophenyl)-4,4a,5,6,7,7a-hexahydropyrrolo[3,4-d][1,3]thiazin-1-ium-2-yl]benzamide |
| SMILES | CC(=O)Nc1ccc(F)c([N+]2=C(NC(=O)c3ccccc3)SC[C@@H]3CNC[C@@H]32)c1 |
| InChI | InChI=1S/C21H21FN4O2S/c1-13(27)24-16-7-8-17(22)18(9-16)26-19-11-23-10-15(19)12-29-21(26)25-20(28)14-5-3-2-4-6-14/h2-9,15,19,23H,10-12H2,1H3,(H,24,27)/p+1/t15-,19-/m0/s1 |
| InChIKey | GGLXDVAPHVDWIA-KXBFYZLASA-O |
| XLogP | 2.55 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|