C32H42O11Si — CID 140806682
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]oxan-2-yl]methyl acetate (PubChem CID 140806682) has the molecular formula C32H42O11Si and a molecular weight of 630.76 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 140806682 |
| Molecular Formula | C32H42O11Si |
| Molecular Weight | 630.76 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H42O11Si/c1-21(33)38-20-27-28(40-22(2)34)29(41-23(3)35)30(42-24(4)36)31(43-27)37-18-19-39-44(32(5,6)7,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-17,27-31H,18-20H2,1-7H3/t27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | RBRRIGDVRFSZNT-PXPWAULYSA-N |
| XLogP | 2.66 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|