C38H46 — CID 140807096
2-[2-[2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)-4-tert-butylphenyl]-5-tert-butylphenyl]-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 140807096) has the molecular formula C38H46 and a molecular weight of 502.79 g/mol. Its IUPAC name is 2-[2-[2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)-4-tert-butylphenyl]-5-tert-butylphenyl]-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 2-[2-[2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)-4-tert-butylphenyl]-5-tert-butylphenyl]-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 140807096 |
| Molecular Formula | C38H46 |
| Molecular Weight | 502.79 g/mol |
| Exact Mass | 502.36 |
| IUPAC Name | 2-[2-[2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)-4-tert-butylphenyl]-5-tert-butylphenyl]-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CC(C)(C)c1ccc(-c2ccc(C(C)(C)C)cc2C2CC3C=CC=CC3C2)c(C2CC3C=CC=CC3C2)c1 |
| InChI | InChI=1S/C38H46/c1-37(2,3)31-15-17-33(35(23-31)29-19-25-11-7-8-12-26(25)20-29)34-18-16-32(38(4,5)6)24-36(34)30-21-27-13-9-10-14-28(27)22-30/h7-18,23-30H,19-22H2,1-6H3 |
| InChIKey | UTGZJOHGGCLFIQ-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.79 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |