C23H36O6SSi — CID 140807459
methyl (2S,3S,4R,5R,6R)-6-[(E)-2-(benzenesulfonyl)ethenyl]-3,5-dimethyl-4-triethylsilyloxyoxane-2-carboxylate (PubChem CID 140807459) has the molecular formula C23H36O6SSi and a molecular weight of 468.69 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6R)-6-[(E)-2-(benzenesulfonyl)ethenyl]-3,5-dimethyl-4-triethylsilyloxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6R)-6-[(E)-2-(benzenesulfonyl)ethenyl]-3,5-dimethyl-4-triethylsilyloxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 140807459 |
| Molecular Formula | C23H36O6SSi |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | methyl (2S,3S,4R,5R,6R)-6-[(E)-2-(benzenesulfonyl)ethenyl]-3,5-dimethyl-4-triethylsilyloxyoxane-2-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@@H](C(=O)OC)O[C@@H](/C=C/S(=O)(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C23H36O6SSi/c1-7-31(8-2,9-3)29-21-17(4)20(28-22(18(21)5)23(24)27-6)15-16-30(25,26)19-13-11-10-12-14-19/h10-18,20-22H,7-9H2,1-6H3/b16-15+/t17-,18-,20+,21-,22+/m1/s1 |
| InChIKey | MIENEKSRGRYLKM-OSPHERGGSA-N |
| XLogP | 4.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|