C22H35IO4SSi — CID 140807460
[(2R,3R,4R,5S,6S)-2-[(E)-2-(benzenesulfonyl)ethenyl]-6-(iodomethyl)-3,5-dimethyloxan-4-yl]oxy-triethylsilane (PubChem CID 140807460) has the molecular formula C22H35IO4SSi and a molecular weight of 550.58 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-2-[(E)-2-(benzenesulfonyl)ethenyl]-6-(iodomethyl)-3,5-dimethyloxan-4-yl]oxy-triethylsilane.
| Compound Name | [(2R,3R,4R,5S,6S)-2-[(E)-2-(benzenesulfonyl)ethenyl]-6-(iodomethyl)-3,5-dimethyloxan-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 140807460 |
| Molecular Formula | C22H35IO4SSi |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-2-[(E)-2-(benzenesulfonyl)ethenyl]-6-(iodomethyl)-3,5-dimethyloxan-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@@H](CI)O[C@@H](/C=C/S(=O)(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C22H35IO4SSi/c1-6-29(7-2,8-3)27-22-17(4)20(26-21(16-23)18(22)5)14-15-28(24,25)19-12-10-9-11-13-19/h9-15,17-18,20-22H,6-8,16H2,1-5H3/b15-14+/t17-,18+,20+,21-,22-/m1/s1 |
| InChIKey | YGWJZZVWWJJSCA-DOZCZLCLSA-N |
| XLogP | 5.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|