C22H38O5SSi — CID 140807464
[(2S,3S,4R,5R,6S)-6-[2-(benzenesulfonyl)ethyl]-3,5-dimethyl-4-triethylsilyloxyoxan-2-yl]methanol (PubChem CID 140807464) has the molecular formula C22H38O5SSi and a molecular weight of 442.69 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-6-[2-(benzenesulfonyl)ethyl]-3,5-dimethyl-4-triethylsilyloxyoxan-2-yl]methanol.
| Compound Name | [(2S,3S,4R,5R,6S)-6-[2-(benzenesulfonyl)ethyl]-3,5-dimethyl-4-triethylsilyloxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 140807464 |
| Molecular Formula | C22H38O5SSi |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-6-[2-(benzenesulfonyl)ethyl]-3,5-dimethyl-4-triethylsilyloxyoxan-2-yl]methanol |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@@H](CO)O[C@@H](CCS(=O)(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C22H38O5SSi/c1-6-29(7-2,8-3)27-22-17(4)20(26-21(16-23)18(22)5)14-15-28(24,25)19-12-10-9-11-13-19/h9-13,17-18,20-23H,6-8,14-16H2,1-5H3/t17-,18+,20+,21-,22-/m1/s1 |
| InChIKey | KQXPMUVQCSDRFF-OCFWJZSCSA-N |
| XLogP | 4.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|