C22H36O4SSi — CID 140807472
(1E,3R,4R,5S,6S)-1-(benzenesulfonyl)-4,6-dimethyl-5-triethylsilyloxyocta-1,7-dien-3-ol (PubChem CID 140807472) has the molecular formula C22H36O4SSi and a molecular weight of 424.68 g/mol. Its IUPAC name is (1E,3R,4R,5S,6S)-1-(benzenesulfonyl)-4,6-dimethyl-5-triethylsilyloxyocta-1,7-dien-3-ol.
| Compound Name | (1E,3R,4R,5S,6S)-1-(benzenesulfonyl)-4,6-dimethyl-5-triethylsilyloxyocta-1,7-dien-3-ol |
|---|---|
| PubChem CID | 140807472 |
| Molecular Formula | C22H36O4SSi |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (1E,3R,4R,5S,6S)-1-(benzenesulfonyl)-4,6-dimethyl-5-triethylsilyloxyocta-1,7-dien-3-ol |
| SMILES | C=C[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](O)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H36O4SSi/c1-7-18(5)22(26-28(8-2,9-3)10-4)19(6)21(23)16-17-27(24,25)20-14-12-11-13-15-20/h7,11-19,21-23H,1,8-10H2,2-6H3/b17-16+/t18-,19+,21-,22-/m0/s1 |
| InChIKey | IWWYKAUDRCIRCD-RQHQOVGOSA-N |
| XLogP | 5.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|