C28H52O4SSi2 — CID 140807474
[(1S,2R,3S)-5-(benzenesulfonyl)-1-[(2S)-but-3-en-2-yl]-2-methyl-3-triethylsilyloxypentoxy]-triethylsilane (PubChem CID 140807474) has the molecular formula C28H52O4SSi2 and a molecular weight of 540.96 g/mol. Its IUPAC name is [(1S,2R,3S)-5-(benzenesulfonyl)-1-[(2S)-but-3-en-2-yl]-2-methyl-3-triethylsilyloxypentoxy]-triethylsilane.
| Compound Name | [(1S,2R,3S)-5-(benzenesulfonyl)-1-[(2S)-but-3-en-2-yl]-2-methyl-3-triethylsilyloxypentoxy]-triethylsilane |
|---|---|
| PubChem CID | 140807474 |
| Molecular Formula | C28H52O4SSi2 |
| Molecular Weight | 540.96 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | [(1S,2R,3S)-5-(benzenesulfonyl)-1-[(2S)-but-3-en-2-yl]-2-methyl-3-triethylsilyloxypentoxy]-triethylsilane |
| SMILES | C=C[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@H](C)[C@H](CCS(=O)(=O)c1ccccc1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H52O4SSi2/c1-10-24(8)28(32-35(14-5,15-6)16-7)25(9)27(31-34(11-2,12-3)13-4)22-23-33(29,30)26-20-18-17-19-21-26/h10,17-21,24-25,27-28H,1,11-16,22-23H2,2-9H3/t24-,25+,27-,28-/m0/s1 |
| InChIKey | HPWVBLXSQYYHJP-XPCWZZLQSA-N |
| XLogP | 8.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.96 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|