C28H50O6Si — CID 140808402
(3aR,7S,7aR)-3a-[(Z)-8,8-dimethoxyoct-1-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one (PubChem CID 140808402) has the molecular formula C28H50O6Si and a molecular weight of 510.79 g/mol. Its IUPAC name is (3aR,7S,7aR)-3a-[(Z)-8,8-dimethoxyoct-1-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one.
| Compound Name | (3aR,7S,7aR)-3a-[(Z)-8,8-dimethoxyoct-1-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 140808402 |
| Molecular Formula | C28H50O6Si |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | (3aR,7S,7aR)-3a-[(Z)-8,8-dimethoxyoct-1-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one |
| SMILES | COC(CCCCC/C=C\[C@@]12OC(C)(C)O[C@@H]1[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C=CC2=O)OC |
| InChI | InChI=1S/C28H50O6Si/c1-20(2)35(21(3)4,22(5)6)33-23-17-18-24(29)28(26(23)32-27(7,8)34-28)19-15-13-11-12-14-16-25(30-9)31-10/h15,17-23,25-26H,11-14,16H2,1-10H3/b19-15-/t23-,26+,28-/m0/s1 |
| InChIKey | KFQOWKYAFNCHDT-WEOPJQABSA-N |
| XLogP | 6.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|