C23H40O5Si — CID 140808405
5-[(3aR,7aR)-2,2-dimethyl-4-oxo-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-3a-yl]pentanal (PubChem CID 140808405) has the molecular formula C23H40O5Si and a molecular weight of 424.65 g/mol. Its IUPAC name is 5-[(3aR,7aR)-2,2-dimethyl-4-oxo-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-3a-yl]pentanal.
| Compound Name | 5-[(3aR,7aR)-2,2-dimethyl-4-oxo-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-3a-yl]pentanal |
|---|---|
| PubChem CID | 140808405 |
| Molecular Formula | C23H40O5Si |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 5-[(3aR,7aR)-2,2-dimethyl-4-oxo-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-3a-yl]pentanal |
| SMILES | CC(C)[Si](OC1C=CC(=O)[C@]2(CCCCC=O)OC(C)(C)O[C@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H40O5Si/c1-16(2)29(17(3)4,18(5)6)27-19-12-13-20(25)23(14-10-9-11-15-24)21(19)26-22(7,8)28-23/h12-13,15-19,21H,9-11,14H2,1-8H3/t19?,21-,23+/m1/s1 |
| InChIKey | OXKZIRFTDJKIHT-LVPCDLKWSA-N |
| XLogP | 5.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|