C25H44O6Si — CID 140808406
(3aR,7aR)-3a-[(Z)-5,5-dimethoxypent-1-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one (PubChem CID 140808406) has the molecular formula C25H44O6Si and a molecular weight of 468.71 g/mol. Its IUPAC name is (3aR,7aR)-3a-[(Z)-5,5-dimethoxypent-1-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one.
| Compound Name | (3aR,7aR)-3a-[(Z)-5,5-dimethoxypent-1-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 140808406 |
| Molecular Formula | C25H44O6Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | (3aR,7aR)-3a-[(Z)-5,5-dimethoxypent-1-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one |
| SMILES | COC(CC/C=C\[C@@]12OC(C)(C)O[C@@H]1C(O[Si](C(C)C)(C(C)C)C(C)C)C=CC2=O)OC |
| InChI | InChI=1S/C25H44O6Si/c1-17(2)32(18(3)4,19(5)6)30-20-14-15-21(26)25(23(20)29-24(7,8)31-25)16-12-11-13-22(27-9)28-10/h12,14-20,22-23H,11,13H2,1-10H3/b16-12-/t20?,23-,25+/m1/s1 |
| InChIKey | JPWXXPKSAGHDJM-LRBSRXHNSA-N |
| XLogP | 5.53 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|