C35H64O4Si — CID 140808412
(3aR,7S,7aR)-3a-[(Z)-heptadec-8-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one (PubChem CID 140808412) has the molecular formula C35H64O4Si and a molecular weight of 576.98 g/mol. Its IUPAC name is (3aR,7S,7aR)-3a-[(Z)-heptadec-8-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one.
| Compound Name | (3aR,7S,7aR)-3a-[(Z)-heptadec-8-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 140808412 |
| Molecular Formula | C35H64O4Si |
| Molecular Weight | 576.98 g/mol |
| Exact Mass | 576.46 |
| IUPAC Name | (3aR,7S,7aR)-3a-[(Z)-heptadec-8-enyl]-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-7,7a-dihydro-1,3-benzodioxol-4-one |
| SMILES | CCCCCCCC/C=C\CCCCCCC[C@@]12OC(C)(C)O[C@@H]1[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C=CC2=O |
| InChI | InChI=1S/C35H64O4Si/c1-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27-35-32(36)26-25-31(33(35)37-34(8,9)39-35)38-40(28(2)3,29(4)5)30(6)7/h17-18,25-26,28-31,33H,10-16,19-24,27H2,1-9H3/b18-17-/t31-,33+,35-/m0/s1 |
| InChIKey | LPYXSNMHIYIZRL-FDWIHHRKSA-N |
| XLogP | 10.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.98 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|