About (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide
(4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide (PubChem CID 140808998) has the molecular formula C23H30N4OS
and a molecular weight of 410.59 g/mol. Its IUPAC name is (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide.
Molecular Properties
| Compound Name | (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide |
| PubChem CID | 140808998 |
| Molecular Formula | C23H30N4OS |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide |
| SMILES | CC[C@H](CC(C)(C)S(N)=O)c1cc(-n2c(C)ccc2C)nnc1-c1ccccc1 |
| InChI | InChI=1S/C23H30N4OS/c1-6-18(15-23(4,5)29(24)28)20-14-21(27-16(2)12-13-17(27)3)25-26-22(20)19-10-8-7-9-11-19/h7-14,18H,6,15,24H2,1-5H3/t18-,29?/m1/s1 |
| InChIKey | JGLIGOHCDJGUAR-QHSQBYJISA-N |
| XLogP | 4.84 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide?
The IUPAC name of (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide (CID 140808998) is (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide.
What is the SMILES notation for (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide?
The canonical SMILES for (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide is CC[C@H](CC(C)(C)S(N)=O)c1cc(-n2c(C)ccc2C)nnc1-c1ccccc1.
What is the InChIKey of (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide?
The InChIKey is JGLIGOHCDJGUAR-QHSQBYJISA-N. The full InChI is InChI=1S/C23H30N4OS/c1-6-18(15-23(4,5)29(24)28)20-14-21(27-16(2)12-13-17(27)3)25-26-22(20)19-10-8-7-9-11-19/h7-14,18H,6,15,24H2,1-5H3/t18-,29?/m1/s1.
What are the key properties of (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide?
(4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide has a molecular weight of 410.59 g/mol, XLogP of 4.84, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[6-(2,5-dimethylpyrrol-1-yl)-3-phenylpyridazin-4-yl]-2-methylhexane-2-sulfinamide is sourced from PubChem (CID 140808998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).