C15H26O6Si — CID 140809343
[(1R,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate (PubChem CID 140809343) has the molecular formula C15H26O6Si and a molecular weight of 330.45 g/mol. Its IUPAC name is [(1R,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate.
| Compound Name | [(1R,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate |
|---|---|
| PubChem CID | 140809343 |
| Molecular Formula | C15H26O6Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [(1R,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate |
| SMILES | CC(=O)O[C@@]12C[C@@H](OC1=O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C15H26O6Si/c1-9(16)20-15-7-10(19-13(15)18)12(17)11(8-15)21-22(5,6)14(2,3)4/h10-12,17H,7-8H2,1-6H3/t10-,11-,12+,15-/m1/s1 |
| InChIKey | VCCNATRAXDNKHB-MCYUEQNJSA-N |
| XLogP | 1.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|