C33H51N3O3 — CID 140809558
N-[4-butan-2-yl-3-[(4-tert-butylcyclohexanecarbonyl)amino]-5-isocyanatophenyl]-4-tert-butylcyclohexane-1-carboxamide (PubChem CID 140809558) has the molecular formula C33H51N3O3 and a molecular weight of 537.79 g/mol. Its IUPAC name is N-[4-butan-2-yl-3-[(4-tert-butylcyclohexanecarbonyl)amino]-5-isocyanatophenyl]-4-tert-butylcyclohexane-1-carboxamide.
| Compound Name | N-[4-butan-2-yl-3-[(4-tert-butylcyclohexanecarbonyl)amino]-5-isocyanatophenyl]-4-tert-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140809558 |
| Molecular Formula | C33H51N3O3 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.39 |
| IUPAC Name | N-[4-butan-2-yl-3-[(4-tert-butylcyclohexanecarbonyl)amino]-5-isocyanatophenyl]-4-tert-butylcyclohexane-1-carboxamide |
| SMILES | CCC(C)c1c(N=C=O)cc(NC(=O)C2CCC(C(C)(C)C)CC2)cc1NC(=O)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C33H51N3O3/c1-9-21(2)29-27(34-20-37)18-26(35-30(38)22-10-14-24(15-11-22)32(3,4)5)19-28(29)36-31(39)23-12-16-25(17-13-23)33(6,7)8/h18-19,21-25H,9-17H2,1-8H3,(H,35,38)(H,36,39) |
| InChIKey | NOVLLCIIYKKNEO-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|